5-(Dimethylamino)-4,4-dimethyl-1,5-diphenyl-1-pentanone structure
|
Common Name | 5-(Dimethylamino)-4,4-dimethyl-1,5-diphenyl-1-pentanone | ||
|---|---|---|---|---|
| CAS Number | 2921-06-4 | Molecular Weight | 309.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(dimethylamino)-4,4-dimethyl-1,5-diphenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H27NO |
|---|---|
| Molecular Weight | 309.44500 |
| Exact Mass | 309.20900 |
| PSA | 20.31000 |
| LogP | 4.97860 |
| Vapour Pressure | 1.11E-07mmHg at 25°C |
| InChIKey | POQYLIRQJVCPSX-UHFFFAOYSA-N |
| SMILES | CN(C)C(c1ccccc1)C(C)(C)CCC(=O)c1ccccc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,5-Diphenyl-2,2-dimethyl-1-dimethylamino-5-pentanone |