4H-1-Benzopyran-4-one,3-(hydroxymethyl)-2-phenyl- structure
|
Common Name | 4H-1-Benzopyran-4-one,3-(hydroxymethyl)-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 29210-21-7 | Molecular Weight | 252.26500 | |
| Density | 1.288g/cm3 | Boiling Point | 441.7ºC at 760 mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8ºC | |
| Name | 3-(hydroxymethyl)-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 441.7ºC at 760 mmHg |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 168.8ºC |
| Exact Mass | 252.07900 |
| PSA | 50.44000 |
| LogP | 2.95230 |
| Vapour Pressure | 1.4E-08mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | DCSFUNSXESBPKG-UHFFFAOYSA-N |
| SMILES | O=c1c(CO)c(-c2ccccc2)oc2ccccc12 |
| HS Code | 2914400090 |
|---|
|
~%
4H-1-Benzopyran... CAS#:29210-21-7 |
| Literature: Litkei, Gyoergy; Patonay, Tamas; Szilagyi, Laszlo; Dinya, Zoltan Organic Preparations and Procedures International, 1991 , vol. 23, # 6 p. 741 - 748 |
|
~%
4H-1-Benzopyran... CAS#:29210-21-7 |
| Literature: Wurm, Gotthard; Nordmann, Matthias Archiv der Pharmazie (Weinheim, Germany), 1988 , vol. 321, p. 555 - 558 |
|
~%
4H-1-Benzopyran... CAS#:29210-21-7 |
| Literature: Wurm, Gotthard; Nordmann, Matthias Archiv der Pharmazie (Weinheim, Germany), 1988 , vol. 321, p. 555 - 558 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-Hydroxymethylflavone |
| 3-Hydroxymethyl-flavon |