4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid
Modify Date: 2025-08-24 17:31:53
4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid structure
|
Common Name | 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2925099-97-2 | Molecular Weight | 273.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11N3O4 |
|---|---|
| Molecular Weight | 273.24 |
| InChIKey | SWQVVHVZMXVQOL-UHFFFAOYSA-N |
| SMILES | O=C1CCN(c2cccc3[nH]c(C(=O)O)cc23)C(=O)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid? |
| A: CAS number of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid is 2925099-97-2. |
| Q: What is the Chinese name of 2925099-97-2? |
| A: Chinese name of 2925099-97-2 is 2925099-97-2. |
| Q: What is the molecular weight of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid? |
| A: Molecular weight of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid is 273.24. |
| Q: What is the English name of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid? |
| A: The English name of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid is 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid. |
| Q: What is the SMILES notation of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid? |
| A: SMILES notation of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid is O=C1CCN(c2cccc3[nH]c(C(=O)O)cc23)C(=O)N1. |
| Q: What is the molecular formula of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid? |
| A: Molecular formula of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid is C13H11N3O4. |
| Q: What is the InChIKey of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid? |
| A: InChIKey of 4-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-2-carboxylic acid is SWQVVHVZMXVQOL-UHFFFAOYSA-N. |