1-bromo-3-(chloromethyl)-2,4,5,6-tetrafluorobenzene structure
|
Common Name | 1-bromo-3-(chloromethyl)-2,4,5,6-tetrafluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 292621-52-4 | Molecular Weight | 277.44100 | |
| Density | 1.847g/cm3 | Boiling Point | 216ºC at 760 mmHg | |
| Molecular Formula | C7H2BrClF4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84.5ºC | |
| Name | 1-bromo-3-(chloromethyl)-2,4,5,6-tetrafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.847g/cm3 |
|---|---|
| Boiling Point | 216ºC at 760 mmHg |
| Molecular Formula | C7H2BrClF4 |
| Molecular Weight | 277.44100 |
| Flash Point | 84.5ºC |
| Exact Mass | 275.89600 |
| LogP | 3.74430 |
| Vapour Pressure | 0.21mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | AFJVCDLDDPSNFM-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(Br)c(F)c(CCl)c1F |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| B175 |
| 3-Bromo-2,4,5,6-tetrafluorobenzyl chloride |