3-[5-(2-METHYL-4-NITRO-PHENYL)-FURAN-2-YL]-ACRYLIC ACID structure
|
Common Name | 3-[5-(2-METHYL-4-NITRO-PHENYL)-FURAN-2-YL]-ACRYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 292641-22-6 | Molecular Weight | 273.24100 | |
| Density | 1.357g/cm3 | Boiling Point | 461.4ºC at 760 mmHg | |
| Molecular Formula | C14H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.9ºC | |
| Name | 3-[5-(2-methyl-4-nitrophenyl)furan-2-yl]prop-2-enoic acid |
|---|
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 461.4ºC at 760 mmHg |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24100 |
| Flash Point | 232.9ºC |
| Exact Mass | 273.06400 |
| PSA | 96.26000 |
| LogP | 3.78420 |
| Vapour Pressure | 2.6E-09mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | CGSJRTMBJMQGOB-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1ccc(C=CC(=O)O)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |