2,3,3,3-Tetrafluoro-2-(trifluoromethoxy)propionyl fluoride structure
|
Common Name | 2,3,3,3-Tetrafluoro-2-(trifluoromethoxy)propionyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2927-83-5 | Molecular Weight | 232.02900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,3,3-Tetrafluoro-2-(trifluoromethoxy)propionyl fluoride |
|---|
| Molecular Formula | C4F8O2 |
|---|---|
| Molecular Weight | 232.02900 |
| Exact Mass | 231.97700 |
| PSA | 26.30000 |
| LogP | 2.24700 |
| Vapour Pressure | 292mmHg at 25°C |
| InChIKey | GAKSVIQMUADMSK-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(OC(F)(F)F)C(F)(F)F |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |