5-phenyl-4H-pyrazolo<1,5-a>pyrimidin-7-one
Modify Date: 2025-09-26 14:29:07
5-phenyl-4H-pyrazolo<1,5-a>pyrimidin-7-one structure
|
Common Name | 5-phenyl-4H-pyrazolo<1,5-a>pyrimidin-7-one | ||
|---|---|---|---|---|
| CAS Number | 29274-13-3 | Molecular Weight | 211.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-4H-pyrazolo<1,5-a>pyrimidin-7-one |
|---|
| Molecular Formula | C12H9N3O |
|---|---|
| Molecular Weight | 211.21900 |
| Exact Mass | 211.07500 |
| PSA | 50.16000 |
| LogP | 1.68960 |
| InChIKey | KUCBMSUTIBMISH-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)nc2cc[nH]n12 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![7-chloro-5-phenylpyrazolo[1,5-a]pyrimidine structure](https://image.chemsrc.com/caspic/371/33149-25-6.png)
CAS#:33149-25-6|
Name: In vitro antischistosomal activity, minimum active concentration to cause severe dama...
Source: ChEMBL
Target: Schistosoma mansoni
External Id: CHEMBL806384
|
|
Name: ASTRAZENECA: Octan-1-ol/water (pH7.4) distribution coefficent measured by a shake fl...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3301363
|
|
Name: ASTRAZENECA: Solubility in pH7.4 buffer using solid starting material using the metho...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3301364
|
Total 3, Current Page 1 of 1
1