2-(bromomethyl)-3-(2-methoxyphenyl)quinazolin-4-one structure
|
Common Name | 2-(bromomethyl)-3-(2-methoxyphenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 292833-07-9 | Molecular Weight | 345.19100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(bromomethyl)-3-(2-methoxyphenyl)quinazolin-4-one |
|---|
| Molecular Formula | C16H13BrN2O2 |
|---|---|
| Molecular Weight | 345.19100 |
| Exact Mass | 344.01600 |
| PSA | 44.12000 |
| LogP | 3.28920 |
| InChIKey | CEIABUKVZISIJG-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-n1c(CBr)nc2ccccc2c1=O |
|
~60%
2-(bromomethyl)... CAS#:292833-07-9 |
| Literature: Rani, Preeti; Archana; Srivastava; Kumar, Ashok Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 12 p. 2642 - 2646 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |