acetic acid,(3-chlorophenyl)methanediol
acetic acid,(3-chlorophenyl)methanediol structure
|
Common Name | acetic acid,(3-chlorophenyl)methanediol | ||
|---|---|---|---|---|
| CAS Number | 2929-92-2 | Molecular Weight | 278.68600 | |
| Density | 1.268g/cm3 | Boiling Point | 315.987ºC at 760 mmHg | |
| Molecular Formula | C11H15ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.842ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,(3-chlorophenyl)methanediol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 315.987ºC at 760 mmHg |
| Molecular Formula | C11H15ClO6 |
| Molecular Weight | 278.68600 |
| Flash Point | 126.842ºC |
| Exact Mass | 278.05600 |
| PSA | 115.06000 |
| LogP | 1.50500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | LTFBMLFNBXDLFR-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.OC(O)c1cccc(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
acetic acid,(3-... CAS#:2929-92-2 |
| Literature: Moosavifar, Maryam; Tangestaninejad, Shahram; Moghadam, Majid; Mirkhani, Valiollah; Mohammadpoor-Baltork, Iraj Comptes Rendus Chimie, 2011 , vol. 14, # 10 p. 953 - 956 |
|
~%
acetic acid,(3-... CAS#:2929-92-2 |
| Literature: Toray Industries, Inc. Patent: US6278019 B1, 2001 ; |
|
~%
acetic acid,(3-... CAS#:2929-92-2 |
| Literature: Toray Industries, Inc. Patent: US6278019 B1, 2001 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
CAS#:1866-38-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Chlor-3-diacetoxymethyl-benzol |
| m-chlorobenzylidene diacetate |
| 3-chlorobenzaldehyde-1,1-diacetate |
| 1-chloro-3-diacetoxymethyl-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of acetic acid,(3-chlorophenyl)methanediol? |
| A: CAS number of acetic acid,(3-chlorophenyl)methanediol is 2929-92-2. |
| Q: What is the polar surface area (PSA) of acetic acid,(3-chlorophenyl)methanediol? |
| A: Polar surface area (PSA) of acetic acid,(3-chlorophenyl)methanediol is 115.06000. |
| Q: What is the boiling point of acetic acid,(3-chlorophenyl)methanediol? |
| A: Boiling point of acetic acid,(3-chlorophenyl)methanediol is 315.987ºC at 760 mmHg. |
| Q: What English synonyms does acetic acid,(3-chlorophenyl)methanediol have? |
| A: English synonyms of acetic acid,(3-chlorophenyl)methanediol: 1-Chlor-3-diacetoxymethyl-benzol, m-chlorobenzylidene diacetate, 3-chlorobenzaldehyde-1,1-diacetate, 1-chloro-3-diacetoxymethyl-benzene. |
| Q: What is the LogP of acetic acid,(3-chlorophenyl)methanediol? |
| A: LogP of acetic acid,(3-chlorophenyl)methanediol is 1.50500. |
| Q: What is the molecular formula of acetic acid,(3-chlorophenyl)methanediol? |
| A: Molecular formula of acetic acid,(3-chlorophenyl)methanediol is C11H15ClO6. |
| Q: What is the English name of acetic acid,(3-chlorophenyl)methanediol? |
| A: The English name of acetic acid,(3-chlorophenyl)methanediol is acetic acid,(3-chlorophenyl)methanediol. |
| Q: What are the downstream products of acetic acid,(3-chlorophenyl)methanediol? |
| A: Related downstream products(CAS) of acetic acid,(3-chlorophenyl)methanediol: 587-04-2;1866-38-2. |
| Q: What is the molecular weight of acetic acid,(3-chlorophenyl)methanediol? |
| A: Molecular weight of acetic acid,(3-chlorophenyl)methanediol is 278.68600. |
| Q: What is the InChIKey of acetic acid,(3-chlorophenyl)methanediol? |
| A: InChIKey of acetic acid,(3-chlorophenyl)methanediol is LTFBMLFNBXDLFR-UHFFFAOYSA-N. |