3-carboxymethylhistidine structure
|
Common Name | 3-carboxymethylhistidine | ||
|---|---|---|---|---|
| CAS Number | 2930-79-2 | Molecular Weight | 213.19100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-amino-3-[3-(carboxymethyl)imidazol-4-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H11N3O4 |
|---|---|
| Molecular Weight | 213.19100 |
| Exact Mass | 213.07500 |
| PSA | 118.44000 |
| Index of Refraction | 1.653 |
| InChIKey | CHEAAAHBJYHHLA-LURJTMIESA-N |
| SMILES | NC(Cc1cncn1CC(=O)O)C(=O)O |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Carboxymethyl-5-histidin |
| 3-carboxymethyl-histidine |
| p-Carboxymethyl-L-histidin |