1,4-bis[(3-chloro-2-hydroxypropyl)amino]anthraquinone
Modify Date: 2025-10-02 23:44:12
![1,4-bis[(3-chloro-2-hydroxypropyl)amino]anthraquinone Structure](https://image.chemsrc.com/caspic/181/29311-94-2.png)
1,4-bis[(3-chloro-2-hydroxypropyl)amino]anthraquinone structure
|
Common Name | 1,4-bis[(3-chloro-2-hydroxypropyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 29311-94-2 | Molecular Weight | 423.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis[(3-chloro-2-hydroxypropyl)amino]-9,10-anthracenedione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20Cl2N2O4 |
|---|---|
| Molecular Weight | 423.29000 |
| Exact Mass | 422.08000 |
| PSA | 98.66000 |
| LogP | 2.63120 |
| Vapour Pressure | 3.1E-22mmHg at 25°C |
| InChIKey | SYZOCKFTUCTLFQ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCC(O)CCl)ccc(NCC(O)CCl)c21 |
| HS Code | 2922509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![9,10-Anthracenedione,1,4-bis[(2-oxiranylmethyl)amino] structure](https://image.chemsrc.com/caspic/136/78146-26-6.png)
CAS#:78146-26-6| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,4-bis((3-chloro-2-hydroxypropyl)amino)anthraquinone |