p-hydroxybenzenesulphonic acid, compound with aniline (1:1)
Modify Date: 2025-11-26 10:15:49
p-hydroxybenzenesulphonic acid, compound with aniline (1:1) structure
|
Common Name | p-hydroxybenzenesulphonic acid, compound with aniline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 29328-30-1 | Molecular Weight | 267.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | aniline, salt of/the/ p-phenolsulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO4S |
|---|---|
| Molecular Weight | 267.30100 |
| Exact Mass | 267.05700 |
| PSA | 109.00000 |
| LogP | 3.56970 |
| InChIKey | QJTMADZSZSFLHB-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1.O=S(=O)(O)c1ccc(O)cc1 |
| p-hydroxybenzenesulfonic acid, compound with aniline (1:1) |
| 4-Hydroxy-benzenesulfonic acid |
| compound with phenylamine |
| Anilin, Salz der p-Phenolsulfonsaeure |