Cyclohexanol,1-ethenyl-, 1-(3,5-dinitrobenzoate) structure
|
Common Name | Cyclohexanol,1-ethenyl-, 1-(3,5-dinitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 29338-78-1 | Molecular Weight | 320.29700 | |
| Density | 1.33g/cm3 | Boiling Point | 441.4ºC at 760mmHg | |
| Molecular Formula | C15H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | (1-ethenylcyclohexyl) 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 441.4ºC at 760mmHg |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.29700 |
| Flash Point | 180ºC |
| Exact Mass | 320.10100 |
| PSA | 117.94000 |
| LogP | 4.59510 |
| Vapour Pressure | 5.47E-08mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | BHSWHRDJOJWZAS-UHFFFAOYSA-N |
| SMILES | C=CC1(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CCCCC1 |
|
~%
Cyclohexanol,1-... CAS#:29338-78-1 |
| Literature: Cook; Lawrence Journal of the Chemical Society, 1938 , p. 58,62 |
|
~%
Cyclohexanol,1-... CAS#:29338-78-1 |
| Literature: Cook; Lawrence Journal of the Chemical Society, 1938 , p. 58,62 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-dinitro-benzoic acid-(1-vinyl-cyclohexyl ester) |
| 1-Vinylcyclohexyl-3,5-dinitrobenzoat |
| 3,5-Dinitro-benzoesaeure-(1-vinyl-cyclohexylester) |