4,4'-Methylenebis(2,3,5-trimethylphenol) structure
|
Common Name | 4,4'-Methylenebis(2,3,5-trimethylphenol) | ||
|---|---|---|---|---|
| CAS Number | 29366-02-7 | Molecular Weight | 284.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-hydroxy-2,3,5-trimethylphenyl)methyl]-2,3,6-trimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24O2 |
|---|---|
| Molecular Weight | 284.39300 |
| Exact Mass | 284.17800 |
| PSA | 40.46000 |
| LogP | 4.53900 |
| InChIKey | AKRWBYMONJDTKS-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C)c2C)c(C)c(C)c1O |
| HS Code | 2907299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2',3,3',5,5'-Hexamethyl-4,4'-dihydroxydiphenylmethan |