4,4'-Methylenebis(2,3,5,6-tetramethylphenol) structure
|
Common Name | 4,4'-Methylenebis(2,3,5,6-tetramethylphenol) | ||
|---|---|---|---|---|
| CAS Number | 29366-04-9 | Molecular Weight | 256.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O2 |
|---|---|
| Molecular Weight | 256.33900 |
| Exact Mass | 256.14600 |
| PSA | 40.46000 |
| LogP | 3.92220 |
| InChIKey | KBRQWCWVFNLHPU-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(Cc2ccc(O)cc2)c(C)c(C)c1O |
| HS Code | 2907299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-Methylenebis(2,3,5,6-tetramethylphenol) |