4,8,12-Trimethyloctadecanoic acid methyl ester structure
|
Common Name | 4,8,12-Trimethyloctadecanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 29366-66-3 | Molecular Weight | 340.58400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4,8,12-trimethyloctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H44O2 |
|---|---|
| Molecular Weight | 340.58400 |
| Exact Mass | 340.33400 |
| PSA | 26.30000 |
| LogP | 7.15890 |
| InChIKey | DLMMLNWCOULABE-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)CCCC(C)CCCC(C)CCC(=O)OC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Octadecanoic acid,4,8,12-trimethyl-,methyl ester |
| 4,8,12-Trimethyloctadecanoic acid methyl ester |