1,3,5-Triazine-2,4-diamine,6-(2-nitrophenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 29366-71-0 | Molecular Weight | 232.19900 | |
| Density | 1.539g/cm3 | Boiling Point | 589.8ºC at 760 mmHg | |
| Molecular Formula | C9H8N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.5ºC | |
| Name | 2-o-Nitrophenyl-4,6-diamino-s-triazin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 589.8ºC at 760 mmHg |
| Molecular Formula | C9H8N6O2 |
| Molecular Weight | 232.19900 |
| Flash Point | 310.5ºC |
| Exact Mass | 232.07100 |
| PSA | 136.53000 |
| LogP | 2.29680 |
| Vapour Pressure | 6.93E-14mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | KXKDEZZKBTYIFK-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2ccccc2[N+](=O)[O-])n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-Triazine-2,4-diaMine,6-(2-nitrophenyl) |
| 4,6-Diamino-2-<2-nitro-phenyl>-1,3,5-triazin |
| [257] 2,4-Diamino-6-(2-nitrophenyl)-1,3,5-triazine |
| 6-(2-Nitrophenyl)-1,3,5-triazine-2,4-diamine |