1,3,5-Triazine-2,4-diamine,6-(2'-nitro[1,1'-biphenyl]-2-yl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(2'-nitro[1,1'-biphenyl]-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 29366-82-3 | Molecular Weight | 308.29500 | |
| Density | 1.426g/cm3 | Boiling Point | 640.9ºC at 760 mmHg | |
| Molecular Formula | C15H12N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.4ºC | |
| Name | 6-[2-(2-nitrophenyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 640.9ºC at 760 mmHg |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.29500 |
| Flash Point | 341.4ºC |
| Exact Mass | 308.10200 |
| PSA | 136.53000 |
| LogP | 3.96380 |
| Vapour Pressure | 2.54E-16mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | AOGXCLFEBAMIHV-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2ccccc2-c2ccccc2[N+](=O)[O-])n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-o-Nitrobiphenylyl-4,6-diamino-s-triazin |