Decanedioic acid,1,10-bis[2-(phenylmethylene)hydrazide] structure
|
Common Name | Decanedioic acid,1,10-bis[2-(phenylmethylene)hydrazide] | ||
|---|---|---|---|---|
| CAS Number | 29367-20-2 | Molecular Weight | 406.52100 | |
| Density | 1.08g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H30N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis[(E)-benzylideneamino]decanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.52100 |
| Exact Mass | 406.23700 |
| PSA | 82.92000 |
| LogP | 5.18960 |
| Index of Refraction | 1.563 |
| InChIKey | USQNUCNHNDJYHU-DQIQZUARSA-N |
| SMILES | O=C(CCCCCCCCC(=O)NN=Cc1ccccc1)NN=Cc1ccccc1 |
|
~80%
Decanedioic aci... CAS#:29367-20-2 |
| Literature: Kudari, S. M.; Lagali, K. H. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 3 p. 379 - 380 |
|
~%
Decanedioic aci... CAS#:29367-20-2 |
| Literature: Curtius; Steller Journal fuer Praktische Chemie (Leipzig), 1900 , vol. <2> 62, p. 218 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| decanedioic acid bis-benzylidenehydrazide |
| Decandisaeure-bis-benzylidenhydrazid |
| T4328 |
| Sebacinsaeure-bis-benzalhydrazid |