N-(4-Aminophenyl)-2,4-dichlorobenzamide structure
|
Common Name | N-(4-Aminophenyl)-2,4-dichlorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 293737-94-7 | Molecular Weight | 281.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-Aminophenyl)-2,4-dichlorobenzamide |
|---|
| Molecular Formula | C13H10Cl2N2O |
|---|---|
| Molecular Weight | 281.13700 |
| Exact Mass | 280.01700 |
| PSA | 55.12000 |
| LogP | 4.48210 |
| InChIKey | JFHQBECHISXXKM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-Aminopheny... CAS#:293737-94-7 |
| Literature: Young, Douglas D.; Connelly, Colleen M.; Grohmann, Christoph; Deiters, Alexander Journal of the American Chemical Society, 2010 , vol. 132, # 23 p. 7976 - 7981 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |