Benzenesulfonic acid,4-methyl-, 1,2-ethanediylidenedihydrazide (9CI) structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 1,2-ethanediylidenedihydrazide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 29399-56-2 | Molecular Weight | 394.46900 | |
| Density | 1.35g/cm3 | Boiling Point | 575.5ºC at 760mmHg | |
| Molecular Formula | C16H18N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.9ºC | |
| Name | 4-methyl-N-[(E)-[(2E)-2-[(4-methylphenyl)sulfonylhydrazinylidene]ethylidene]amino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 575.5ºC at 760mmHg |
| Molecular Formula | C16H18N4O4S2 |
| Molecular Weight | 394.46900 |
| Flash Point | 301.9ºC |
| Exact Mass | 394.07700 |
| PSA | 133.82000 |
| LogP | 4.47520 |
| Vapour Pressure | 3.01E-13mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | LOSFGYNYLAIPPE-WHYMJUELSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=CC=NNS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~54%
Benzenesulfonic... CAS#:29399-56-2 |
| Literature: Gallucci, Robert R. Journal of Chemical & Engineering Data, 1982 , vol. 27, # 2 p. 217 - 219 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Methyl-N'-(2-(((4-methylphenyl)sulfonyl)hydrazono)ethylidene)benzenesulfonohydrazide |
| Glyoxal-bis-toluolsulfonylhydrazon |