[1,1'-Biphenyl]-2,2'-dicarboxylicacid, 4,4'-dimethyl-, 2,2'-dimethyl ester
![[1,1'-Biphenyl]-2,2'-dicarboxylicacid, 4,4'-dimethyl-, 2,2'-dimethyl ester Structure](https://image.chemsrc.com/caspic/222/2941-80-2.png)
[1,1'-Biphenyl]-2,2'-dicarboxylicacid, 4,4'-dimethyl-, 2,2'-dimethyl ester structure
|
Common Name | [1,1'-Biphenyl]-2,2'-dicarboxylicacid, 4,4'-dimethyl-, 2,2'-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2941-80-2 | Molecular Weight | 298.33300 | |
| Density | 1.134g/cm3 | Boiling Point | 452.8ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 452.8ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 228.4ºC |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.54360 |
| Vapour Pressure | 2.18E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | RZTPBYRDGGSKPG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)ccc1-c1ccc(C)cc1C(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
[1,1'-Biphenyl]... CAS#:2941-80-2 |
| Literature: Takagi, Kentaro; Hayama, Naomi; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 12 p. 3691 - 3695 |
|
~%
[1,1'-Biphenyl]... CAS#:2941-80-2 |
| Literature: Takagi, Kentaro; Hayama, Naomi; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 12 p. 3691 - 3695 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-Dimethylbiphenyl-2,2'-dicarbonsaeuredimethylester |
| Dimethyl-4,4'-Me2-diphenat |
| 4,4'-Dimethyl-diphensaeure-dimethylester |
| 4,4'-dimethyl-diphenic acid dimethyl ester |
| dimethyl 4,4'-dimethyl-2,2'-biphenyldicarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: InChIKey of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is RZTPBYRDGGSKPG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: Molecular weight of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is 298.33300. |
| Q: What is the LogP of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: LogP of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is 3.54360. |
| Q: What is the English name of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: The English name of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate. |
| Q: What is the Chinese name of 2941-80-2? |
| A: Chinese name of 2941-80-2 is 2941-80-2. |
| Q: What is the polar surface area (PSA) of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: Polar surface area (PSA) of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is 52.60000. |
| Q: What are the upstream materials of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: Related upstream materials(CAS) of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate: 103440-52-4;610-97-9. |
| Q: What is the CAS number of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: CAS number of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is 2941-80-2. |
| Q: What is the SMILES notation of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: SMILES notation of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is COC(=O)c1cc(C)ccc1-c1ccc(C)cc1C(=O)OC. |
| Q: What is the molecular formula of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate? |
| A: Molecular formula of methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate is C18H18O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |