[1,1'-Biphenyl]-2,2'-dicarboxylicacid, 4,4'-dimethyl-, 2,2'-dimethyl ester structure
|
Common Name | [1,1'-Biphenyl]-2,2'-dicarboxylicacid, 4,4'-dimethyl-, 2,2'-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2941-80-2 | Molecular Weight | 298.33300 | |
| Density | 1.134g/cm3 | Boiling Point | 452.8ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.4ºC | |
| Name | methyl 2-(2-methoxycarbonyl-4-methylphenyl)-5-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 452.8ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 228.4ºC |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.54360 |
| Vapour Pressure | 2.18E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | RZTPBYRDGGSKPG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)ccc1-c1ccc(C)cc1C(=O)OC |
|
~95%
[1,1'-Biphenyl]... CAS#:2941-80-2 |
| Literature: Takagi, Kentaro; Hayama, Naomi; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 12 p. 3691 - 3695 |
|
~%
[1,1'-Biphenyl]... CAS#:2941-80-2 |
| Literature: Takagi, Kentaro; Hayama, Naomi; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 12 p. 3691 - 3695 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-Dimethylbiphenyl-2,2'-dicarbonsaeuredimethylester |
| Dimethyl-4,4'-Me2-diphenat |
| 4,4'-Dimethyl-diphensaeure-dimethylester |
| 4,4'-dimethyl-diphenic acid dimethyl ester |
| dimethyl 4,4'-dimethyl-2,2'-biphenyldicarboxylate |