Ponatinib N-desmethyl hydrochloride
Modify Date: 2026-07-29 11:05:45
Ponatinib N-desmethyl hydrochloride structure
|
Common Name | Ponatinib N-desmethyl hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2941512-87-2 | Molecular Weight | 555.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H26ClF3N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ponatinib N-desmethyl hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H26ClF3N6O |
|---|---|
| Molecular Weight | 555.0 |
| InChIKey | VFPNPUWARROEFM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCNCC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ponatinib N-desmethyl hydrochloride? |
| A: InChIKey of Ponatinib N-desmethyl hydrochloride is VFPNPUWARROEFM-UHFFFAOYSA-N. |
| Q: What is the CAS number of Ponatinib N-desmethyl hydrochloride? |
| A: CAS number of Ponatinib N-desmethyl hydrochloride is 2941512-87-2. |
| Q: What is the SMILES notation of Ponatinib N-desmethyl hydrochloride? |
| A: SMILES notation of Ponatinib N-desmethyl hydrochloride is Cc1ccc(C(=O)Nc2ccc(CN3CCNCC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12.Cl. |
| Q: What is the English name of Ponatinib N-desmethyl hydrochloride? |
| A: The English name of Ponatinib N-desmethyl hydrochloride is Ponatinib N-desmethyl hydrochloride. |
| Q: What is the molecular weight of Ponatinib N-desmethyl hydrochloride? |
| A: Molecular weight of Ponatinib N-desmethyl hydrochloride is 555.0. |
| Q: What is the molecular formula of Ponatinib N-desmethyl hydrochloride? |
| A: Molecular formula of Ponatinib N-desmethyl hydrochloride is C28H26ClF3N6O. |
| Q: What is the Chinese name of 2941512-87-2? |
| A: Chinese name of 2941512-87-2 is 2941512-87-2. |