2-bromo-4-[2-(3-bromo-4-hydroxy-phenyl)propan-2-yl]phenol structure
|
Common Name | 2-bromo-4-[2-(3-bromo-4-hydroxy-phenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 29426-78-6 | Molecular Weight | 386.07800 | |
| Density | 1.664g/cm3 | Boiling Point | 409.6ºC at 760mmHg | |
| Molecular Formula | C15H14Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5ºC | |
| Name | Dibromobisphenol A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.664g/cm3 |
|---|---|
| Boiling Point | 409.6ºC at 760mmHg |
| Molecular Formula | C15H14Br2O2 |
| Molecular Weight | 386.07800 |
| Flash Point | 201.5ºC |
| Exact Mass | 383.93600 |
| PSA | 40.46000 |
| LogP | 4.94870 |
| Vapour Pressure | 2.7E-07mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | CKNCVRMXCLUOJI-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)c(Br)c1)c1ccc(O)c(Br)c1 |
| HS Code | 2908199090 |
|---|
|
~88%
2-bromo-4-[2-(3... CAS#:29426-78-6 |
| Literature: Mashraqui, Sabir H.; Mudaliar, Chandrashekar D.; Hariharasubrahmanian, Harini Tetrahedron Letters, 1997 , vol. 38, # 27 p. 4865 - 4868 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,2'-dibromo-4,4'-isopropylidene-di-phenol |
| 2-bromo-4-[2-(3-bromo-4-hydroxy-phenyl)propan-2-yl]phenol |
| 2,2'-Dibrom-4,4'-isopropyliden-di-phenol |
| 2,2-bis(3'-bromo-4'-hydroxyphenyl)-propane |
| 2,2-bis(4-hydroxy-3-bromophenyl)propane |
| 3,3'-dibromobisphenol A |
| 2,2-Bis-(3-brom-4-hydroxy-phenyl)-propan |