3a,6-Epoxy-3aH-cyclopentacyclododecene-4,11-dione,2,3,7,8-tetrahydro-2,5,8,8,12-pentamethyl-, (2R,3aR,9E,12Z)- structure
|
Common Name | 3a,6-Epoxy-3aH-cyclopentacyclododecene-4,11-dione,2,3,7,8-tetrahydro-2,5,8,8,12-pentamethyl-, (2R,3aR,9E,12Z)- | ||
|---|---|---|---|---|
| CAS Number | 29444-03-9 | Molecular Weight | 312.40300 | |
| Density | 1.13g/cm3 | Boiling Point | 507.8ºC at 760mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | Jatrophone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 507.8ºC at 760mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 223.9ºC |
| Exact Mass | 312.17300 |
| PSA | 43.37000 |
| LogP | 4.06620 |
| Vapour Pressure | 1.97E-10mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | MJNNONLDVCCGCA-CGHGUHIJSA-N |
| SMILES | CC1=CC2=CC(C)CC23OC(=C(C)C3=O)CC(C)(C)C=CC1=O |
|
~%
3a,6-Epoxy-3aH-... CAS#:29444-03-9 |
| Literature: Han, Qi; Wiemer, David F. Journal of the American Chemical Society, 1992 , vol. 114, # 20 p. 7692 - 7697 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (+)-jatrophone |
| (2R,3aR,9E,12Z)-2,3,7,8-Tetrahydro-2,5,8,8,12-pentamethyl-3a,6-epoxy-3aH-cyclopentacyclododecene-4,11-dione |