5-ethyl-4-phenyl-4H-1,2,4-triazole-3-thiol structure
|
Common Name | 5-ethyl-4-phenyl-4H-1,2,4-triazole-3-thiol | ||
|---|---|---|---|---|
| CAS Number | 29448-76-8 | Molecular Weight | 205.27900 | |
| Density | 1.24g/cm3 | Boiling Point | 286.6ºC at 760 mmHg | |
| Molecular Formula | C10H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.1ºC | |
| Name | 3-ethyl-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 286.6ºC at 760 mmHg |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.27900 |
| Flash Point | 127.1ºC |
| Exact Mass | 205.06700 |
| PSA | 69.51000 |
| LogP | 2.11840 |
| Vapour Pressure | 0.00261mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | CEQSRCVNBFGKSW-UHFFFAOYSA-N |
| SMILES | CCc1n[nH]c(=S)n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~44%
5-ethyl-4-pheny... CAS#:29448-76-8 |
| Literature: Malbec, Frederique; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 1689 - 1698 |
|
~%
5-ethyl-4-pheny... CAS#:29448-76-8 |
| Literature: Reynolds; Van Allan Journal of Organic Chemistry, 1959 , vol. 24, p. 1478,1481 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Mercapto-4-phenyl-5-ethyl-1,2,4-triazole |
| 3H-1,2,4-Triazole-3-thione,5-ethyl-2,4-dihydro-4-phenyl |