sodium 2-sulphoethyl decanoate structure
|
Common Name | sodium 2-sulphoethyl decanoate | ||
|---|---|---|---|---|
| CAS Number | 29454-06-6 | Molecular Weight | 302.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NaO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium 2-sulfoethyl decanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H23NaO5S |
|---|---|
| Molecular Weight | 302.36300 |
| Exact Mass | 302.11600 |
| PSA | 91.88000 |
| LogP | 3.29630 |
| InChIKey | BUGBPNOGBVBQSY-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC(=O)OCCS(=O)(=O)[O-].[Na+] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| decanoic acid, 2-sulfoethyl ester, sodium salt (1:1) |