cyclohexanone oxime benzoyl ester
cyclohexanone oxime benzoyl ester structure
|
Common Name | cyclohexanone oxime benzoyl ester | ||
|---|---|---|---|---|
| CAS Number | 29456-22-2 | Molecular Weight | 217.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of cyclohexanone oxime benzoyl ester is 环己酮肟苯甲酯，with the English name being cyclohexanone oxime benzoyl ester，and the CAS number is 29456-22-2. The molecular formula is C13H15NO2 and the molecular weight is 217.26400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | cyclohexanone oxime benzoyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO2 |
|---|---|
| Molecular Weight | 217.26400 |
| Exact Mass | 217.11000 |
| PSA | 38.66000 |
| LogP | 3.16350 |
| InChIKey | JEANUGXIWGVYFV-UHFFFAOYSA-N |
| SMILES | O=C(ON=C1CCCCC1)c1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| cyclohexanone O-benzoyloxime |
| cyclohexanone-(O-benzoyl oxime ) |
| cyclohexanoneoxime benzoate |
| cyclohexanone oxime benzoate |
| 1-[(benzoyloxy)imino]cyclohexane |
| cyclohexanone O-benzoyl oxime |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of cyclohexanone oxime benzoyl ester? |
| A: InChIKey of cyclohexanone oxime benzoyl ester is JEANUGXIWGVYFV-UHFFFAOYSA-N. |
| Q: What is the CAS number of cyclohexanone oxime benzoyl ester? |
| A: CAS number of cyclohexanone oxime benzoyl ester is 29456-22-2. |
| Q: What is the polar surface area (PSA) of cyclohexanone oxime benzoyl ester? |
| A: Polar surface area (PSA) of cyclohexanone oxime benzoyl ester is 38.66000. |
| Q: What is the Chinese name of 29456-22-2? |
| A: Chinese name of 29456-22-2 is 29456-22-2. |
| Q: What is the LogP of cyclohexanone oxime benzoyl ester? |
| A: LogP of cyclohexanone oxime benzoyl ester is 3.16350. |
| Q: What is the English name of cyclohexanone oxime benzoyl ester? |
| A: The English name of cyclohexanone oxime benzoyl ester is cyclohexanone oxime benzoyl ester. |
| Q: What is the molecular weight of cyclohexanone oxime benzoyl ester? |
| A: Molecular weight of cyclohexanone oxime benzoyl ester is 217.26400. |
| Q: What is the SMILES notation of cyclohexanone oxime benzoyl ester? |
| A: SMILES notation of cyclohexanone oxime benzoyl ester is O=C(ON=C1CCCCC1)c1ccccc1. |
| Q: What English synonyms does cyclohexanone oxime benzoyl ester have? |
| A: English synonyms of cyclohexanone oxime benzoyl ester: cyclohexanone O-benzoyloxime, cyclohexanone-(O-benzoyl oxime ), cyclohexanoneoxime benzoate, cyclohexanone oxime benzoate, 1-[(benzoyloxy)imino]cyclohexane, cyclohexanone O-benzoyl oxime. |
| Q: What is the molecular formula of cyclohexanone oxime benzoyl ester? |
| A: Molecular formula of cyclohexanone oxime benzoyl ester is C13H15NO2. |