1-[7,7-dimethyl-4-(4-methylphenyl)sulfonyloxy-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol structure
|
Common Name | 1-[7,7-dimethyl-4-(4-methylphenyl)sulfonyloxy-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 2946-01-2 | Molecular Weight | 374.40600 | |
| Density | 1.44g/cm3 | Boiling Point | 557.5ºC at 760 mmHg | |
| Molecular Formula | C16H22O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291ºC | |
| Name | [5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 557.5ºC at 760 mmHg |
| Molecular Formula | C16H22O8S |
| Molecular Weight | 374.40600 |
| Flash Point | 291ºC |
| Exact Mass | 374.10400 |
| PSA | 119.90000 |
| LogP | 1.37930 |
| Vapour Pressure | 2.88E-13mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | YHCWPFMBKYICOM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(C(O)CO)OC3OC(C)(C)OC32)cc1 |
|
~99%
1-[7,7-dimethyl... CAS#:2946-01-2 |
| Literature: Singha; Tripathi; Roy; Achari; Mandal Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 10 p. 919 - 924 |
|
~%
1-[7,7-dimethyl... CAS#:2946-01-2 |
| Literature: Singha; Tripathi; Roy; Achari; Mandal Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 10 p. 919 - 924 |
|
~%
1-[7,7-dimethyl... CAS#:2946-01-2 |
| Literature: Singha; Tripathi; Roy; Achari; Mandal Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 10 p. 919 - 924 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |