L 006235 structure
|
Common Name | L 006235 | ||
|---|---|---|---|---|
| CAS Number | 294623-49-7 | Molecular Weight | 466.59900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30N6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L 006235L 006235 is a reversible and potent cathepsin K inhibitor that displays more than a 4000 fold selectivity over cathepsins B, L and S. |
| Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|
| Molecular Formula | C24H30N6O2S |
|---|---|
| Molecular Weight | 466.59900 |
| Exact Mass | 466.21500 |
| PSA | 133.09000 |
| LogP | 3.86848 |
| InChIKey | FIVYCSWOCXEWSE-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2nc(-c3ccc(C(=O)NC4(C(=O)NCC#N)CCCCC4)cc3)cs2)CC1 |