Ganoderic acid Z structure
|
Common Name | Ganoderic acid Z | ||
|---|---|---|---|---|
| CAS Number | 294674-09-2 | Molecular Weight | 514.65 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 700.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C30H42O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.6±29.4 °C | |
Use of Ganoderic acid ZGanoderic acid ζ is a triterpene that can be isolated from the spores of Ganoderma lucidum[1]. |
| Name | Ganoderic acid Z |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid ζ is a triterpene that can be isolated from the spores of Ganoderma lucidum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 700.8±60.0 °C at 760 mmHg |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.65 |
| Flash Point | 391.6±29.4 °C |
| Exact Mass | 514.293030 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | PRJBNEAPLDQWLQ-UHFFFAOYSA-N |
| SMILES | CC(=CC(O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3=O)C(=O)O |
| Lanosta-8,24-dien-26-oic acid, 3,23-dihydroxy-7,11,15-trioxo-, (3β,23S,24E)- |
| (3β,23S,24E)-3,23-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid |