Uracil, 5-butyl-6-methyl- structure
|
Common Name | Uracil, 5-butyl-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 29486-38-2 | Molecular Weight | 182.22000 | |
| Density | 1.063g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-butyl-6-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22000 |
| Exact Mass | 182.10600 |
| PSA | 66.24000 |
| LogP | 1.53880 |
| Index of Refraction | 1.475 |
| InChIKey | VGPMMOYTFOLFEJ-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)[nH]c(=O)[nH]c1=O |
|
~%
Uracil, 5-butyl... CAS#:29486-38-2 |
| Literature: Chi Journal of the American Chemical Society, 1936 , vol. 58, p. 1150 |
|
~%
Uracil, 5-butyl... CAS#:29486-38-2 |
| Literature: Chi Journal of the American Chemical Society, 1936 , vol. 58, p. 1150 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Butyl-6-methyluracil |
| Uracil,5-butyl-6-methyl |
| 5-Butyl-6-methyl-1H-pyrimidin-2,4-dion |