6-(4-fluorophenyl)-3-(4-propylcyclohexyl)cyclohex-2-en-1-one structure
|
Common Name | 6-(4-fluorophenyl)-3-(4-propylcyclohexyl)cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 294865-06-8 | Molecular Weight | 314.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-fluorophenyl)-3-(4-propylcyclohexyl)cyclohex-2-en-1-one |
|---|
| Molecular Formula | C21H27FO |
|---|---|
| Molecular Weight | 314.43700 |
| Exact Mass | 314.20500 |
| PSA | 17.07000 |
| LogP | 5.80510 |
| InChIKey | SVPGQAYJXGMIQN-UHFFFAOYSA-N |
| SMILES | CCCC1CCC(C2=CC(=O)C(c3ccc(F)cc3)CC2)CC1 |
|
~51%
6-(4-fluorophen... CAS#:294865-06-8 |
| Literature: Sasnouski, Genadz; Bezborodov, Vladimir; Dabrowski, Roman; Dziaduszek, Jerzy Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, 2001 , vol. 365, p. 63 - 74 |
|
~%
6-(4-fluorophen... CAS#:294865-06-8 |
| Literature: Sasnouski, Genadz; Bezborodov, Vladimir; Dabrowski, Roman; Dziaduszek, Jerzy Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, 2001 , vol. 365, p. 63 - 74 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |