2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate
Modify Date: 2025-08-26 22:32:50
2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate structure
|
Common Name | 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 294875-97-1 | Molecular Weight | 259.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H25NO3Si |
|---|---|
| Molecular Weight | 259.42 |
| InChIKey | GMGHLDBLZSBMDH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOC(=O)N1CCC(CO)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate? |
| A: Molecular weight of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate is 259.42. |
| Q: What is the English name of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate? |
| A: The English name of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate is 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate. |
| Q: What is the SMILES notation of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate? |
| A: SMILES notation of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate is C[Si](C)(C)CCOC(=O)N1CCC(CO)CC1. |
| Q: What is the CAS number of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate? |
| A: CAS number of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate is 294875-97-1. |
| Q: What is the InChIKey of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate? |
| A: InChIKey of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate is GMGHLDBLZSBMDH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate? |
| A: Molecular formula of 2-Trimethylsilanylethyl 4-hydroxymethylpiperidine-1-carboxylate is C12H25NO3Si. |
| Q: What is the Chinese name of 294875-97-1? |
| A: Chinese name of 294875-97-1 is 294875-97-1. |