butyl 2-methylprop-2-enoate,butyl prop-2-enoate,styrene structure
|
Common Name | butyl 2-methylprop-2-enoate,butyl prop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 29497-14-1 | Molecular Weight | 374.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl 2-methylprop-2-enoate,butyl prop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H34O4 |
|---|---|
| Molecular Weight | 374.51400 |
| Exact Mass | 374.24600 |
| PSA | 52.60000 |
| LogP | 5.75110 |
| InChIKey | SWXQHBVTIYXJQW-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCCC.C=CC(=O)OCCCC.C=Cc1ccccc1 |
| 2-Propenoic acid,2-methyl-,butyl ester,polymer with butyl 2-propenoate and ethenylbenzene |