4-[2-(4-hydroxy-3,5-ditert-butyl-phenyl)ethenyl]-2,6-ditert-butyl-phenol structure
|
Common Name | 4-[2-(4-hydroxy-3,5-ditert-butyl-phenyl)ethenyl]-2,6-ditert-butyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 2950-01-8 | Molecular Weight | 436.66900 | |
| Density | 1g/cm3 | Boiling Point | 488.5ºC at 760 mmHg | |
| Molecular Formula | C30H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethenyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 488.5ºC at 760 mmHg |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.66900 |
| Flash Point | 191.4ºC |
| Exact Mass | 436.33400 |
| PSA | 40.46000 |
| LogP | 8.45820 |
| Vapour Pressure | 3.63E-10mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | AWUDLXWGQXPWFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 3,5,3',5'-tetra-tert-butyl-trans-stilbene-4,4'-diol |
| trans-3,3',5,5'-tetra-tert-butyl-4,4'-dihydroxystilbene |
| 3,5,3',5'-tetra-t-butyl-4,4'-dihydroxystilbene |
| 3,3',5,5'-Tetratert.-butyl-4,4'-dihydroxy-trans-stilben |
| 3,5,3',5'-Tetra-tert-butyl-trans-stilben-4,4'-diol |