b-Alanine,N-[(3-ethoxyacryloyl)carbamoyl]-, ethyl ester (7CI,8CI) structure
|
Common Name | b-Alanine,N-[(3-ethoxyacryloyl)carbamoyl]-, ethyl ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 2950-90-5 | Molecular Weight | 258.27100 | |
| Density | 1.145g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-[[(Z)-3-ethoxyprop-2-enoyl]carbamoylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27100 |
| Exact Mass | 258.12200 |
| PSA | 93.73000 |
| LogP | 1.09740 |
| Index of Refraction | 1.478 |
| InChIKey | LZLBVGVLFCNYEM-VURMDHGXSA-N |
| SMILES | CCOC=CC(=O)NC(=O)NCCC(=O)OCC |
|
~%
b-Alanine,N-[(3... CAS#:2950-90-5 |
| Literature: Martinez,A.P. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 187 - 189 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,3,5-dichloro-,3-(3-pyridyl)propyl ester,hydrochloride |
| 3-<3-(3,5-Dichlor-benzoyloxy)-propyl>-pyridin-hydrochlorid |
| 3-pyridin-3-ylpropyl 3,5-dichlorobenzoate hydrochloride |
| 3-Pyridinepropanol,3,5-dichlorobenzoate (ester),hydrochloride |
| 3-<3-(3-Ethoxy-acryloyl)-ureido>-propionsaeure-ethylester |