Butanoic acid,4-[[[(3-ethoxy-1-oxo-2-propen-1-yl)amino]carbonyl]amino]-, ethyl ester structure
|
Common Name | Butanoic acid,4-[[[(3-ethoxy-1-oxo-2-propen-1-yl)amino]carbonyl]amino]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2950-91-6 | Molecular Weight | 272.29800 | |
| Density | 1.125g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-[[(Z)-3-ethoxyprop-2-enoyl]carbamoylamino]butanoate |
|---|
| Density | 1.125g/cm3 |
|---|---|
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.29800 |
| Exact Mass | 272.13700 |
| PSA | 93.73000 |
| LogP | 1.48750 |
| Index of Refraction | 1.477 |
| InChIKey | HPHORWXDYJMDPG-CLFYSBASSA-N |
| SMILES | CCOC=CC(=O)NC(=O)NCCCC(=O)OCC |
|
~%
Butanoic acid,4... CAS#:2950-91-6 |
| Literature: Martinez,A.P. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 187 - 189 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |