4-amino-2-nonylchromeno[3,4-c]pyridin-5-one structure
|
Common Name | 4-amino-2-nonylchromeno[3,4-c]pyridin-5-one | ||
|---|---|---|---|---|
| CAS Number | 29542-45-8 | Molecular Weight | 338.44300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2-nonylchromeno[3,4-c]pyridin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H26N2O2 |
|---|---|
| Molecular Weight | 338.44300 |
| Exact Mass | 338.19900 |
| PSA | 69.85000 |
| LogP | 5.14660 |
| InChIKey | GXCYKDKXESPFGF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1cc2c(c(N)n1)c(=O)oc1ccccc12 |
|
~%
4-amino-2-nonyl... CAS#:29542-45-8 |
| Literature: Sakurai,A.; Midorikawa,H. Bulletin of the Chemical Society of Japan, 1970 , vol. 43, p. 2925 - 2933 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-n-Nonanyl-4-amino-5-oxo-6-oxabenz<isochinolin |