5-acetyl-2-hydroxy-2,5-dimethyloxolan-3-one structure
|
Common Name | 5-acetyl-2-hydroxy-2,5-dimethyloxolan-3-one | ||
|---|---|---|---|---|
| CAS Number | 29549-78-8 | Molecular Weight | 172.17800 | |
| Density | 1.218g/cm3 | Boiling Point | 298.6ºC at 760 mmHg | |
| Molecular Formula | C8H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.6ºC | |
| Name | 5-acetyl-2-hydroxy-2,5-dimethyloxolan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 298.6ºC at 760 mmHg |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.17800 |
| Flash Point | 120.6ºC |
| Exact Mass | 172.07400 |
| PSA | 63.60000 |
| LogP | 0.03200 |
| Vapour Pressure | 0.000126mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | TUYBNEBXRHKEKQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(C)CC(=O)C(C)(O)O1 |
| HS Code | 2932190090 |
|---|
|
~%
5-acetyl-2-hydr... CAS#:29549-78-8 |
| Literature: Birch; Moye Journal of the Chemical Society, 1957 , p. 412 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| EINECS 249-691-2 |
| dimeric biacetyl |
| 5-acetyl-tetrahydro-2-hydroxy-2,5-dimethyl-3-oxofurane |
| 5-Acetyl-2-hydroxy-2,5-dimethyl-dihydro-furan-3-on |
| 5-Hydroxy-4-oxo-2.5.-dimethyl-2-acetyl-tetrahydrofuran |
| 5-acetyl-2-hydroxy-2,5-dimethyl-dihydro-furan-3-one |
| 5-hydroxy-5-methyl-heptane-2,3,6-trione 2->5-cyclohemiacetal |