Benzenesulfonicacid, 4-nitro-, (ethoxycarbonyl)[(4-nitrophenyl)sulfonyl]azanyl ester structure
|
Common Name | Benzenesulfonicacid, 4-nitro-, (ethoxycarbonyl)[(4-nitrophenyl)sulfonyl]azanyl ester | ||
|---|---|---|---|---|
| CAS Number | 2955-75-1 | Molecular Weight | 475.40700 | |
| Density | 1.632g/cm3 | Boiling Point | 648.8ºC at 760mmHg | |
| Molecular Formula | C15H13N3O11S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.2ºC | |
| Name | ethyl ((4-nitrophenyl)sulfonyl)(((4-nitrophenyl)sulfonyl)oxy)carbamate |
|---|
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 648.8ºC at 760mmHg |
| Molecular Formula | C15H13N3O11S2 |
| Molecular Weight | 475.40700 |
| Flash Point | 346.2ºC |
| Exact Mass | 474.99900 |
| PSA | 215.45000 |
| LogP | 5.17870 |
| Vapour Pressure | 1.02E-16mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | ZOLXZUXKISWHNT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(OS(=O)(=O)c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
Benzenesulfonic... CAS#:2955-75-1 |
| Literature: Lwowski,W.; Maricich,T.J. Journal of the American Chemical Society, 1965 , vol. 87, p. 3630 - 3637 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |