(E)-N-Caffeoylputrescine structure
|
Common Name | (E)-N-Caffeoylputrescine | ||
|---|---|---|---|---|
| CAS Number | 29554-26-5 | Molecular Weight | 250.294 | |
| Density | 1.233±0.06 g/cm3 | Boiling Point | 545.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O3 | Melting Point | 254.5 °C | |
| MSDS | N/A | Flash Point | 283.7±30.1 °C | |
Use of (E)-N-CaffeoylputrescineN-Caffeoylputrescine,(E)- is a caffeic acid amide found in the tobacco plants (Nicotiana tabacum L.)[1]. |
| Name | N-(4-aminobutyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Description | N-Caffeoylputrescine,(E)- is a caffeic acid amide found in the tobacco plants (Nicotiana tabacum L.)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.233±0.06 g/cm3 |
|---|---|
| Boiling Point | 545.5±50.0 °C at 760 mmHg |
| Melting Point | 254.5 °C |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.294 |
| Flash Point | 283.7±30.1 °C |
| Exact Mass | 250.131744 |
| PSA | 99.07000 |
| LogP | 0.41 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | KTZNZCYTXQYEHT-UHFFFAOYSA-N |
| SMILES | NCCCCNC(=O)C=Cc1ccc(O)c(O)c1 |
| Water Solubility | Slightly soluble (6.3 g/L) (25 ºC) |
| (2E)-N-(4-Aminobutyl)-3-(3,4-dihydroxyphenyl)acrylamide |
| Caffeoylputrescine |
| Caffeoylputrescin |
| 2-Propenamide, N-(4-aminobutyl)-3-(3,4-dihydroxyphenyl)-, (2E)- |
| N-Caffeoylputrescine, (E)- |