8H-Benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-8-one,5,6-dihydro-9-hydroxy-10-methoxy- structure
|
Common Name | 8H-Benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-8-one,5,6-dihydro-9-hydroxy-10-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 29580-82-3 | Molecular Weight | 337.32600 | |
| Density | 1.54g/cm3 | Boiling Point | 624.2ºC at 760mmHg | |
| Molecular Formula | C19H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.3ºC | |
| Name | Oxyberberrubine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 624.2ºC at 760mmHg |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.32600 |
| Flash Point | 331.3ºC |
| Exact Mass | 337.09500 |
| PSA | 69.92000 |
| LogP | 2.66750 |
| Vapour Pressure | 3.55E-16mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | CWKBTNZNPCPAPB-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc3n(c(=O)c2c1O)CCc1cc2c(cc1-3)OCO2 |
|
~55%
8H-Benzo[g]-1,3... CAS#:29580-82-3 |
| Literature: Nimgirawath, Surachai; Udomputtimekakul, Phansuang; Apornpisarn, Thitima; Wanbanjob, Asawin; Taechowisan, Thongchai Molecules, 2009 , vol. 14, # 2 p. 726 - 737 |
|
~%
8H-Benzo[g]-1,3... CAS#:29580-82-3 |
| Literature: Govindachari,T.R. et al. Indian Journal of Chemistry, 1970 , vol. 8, p. 766 - 768 |
|
~%
8H-Benzo[g]-1,3... CAS#:29580-82-3 |
| Literature: Kametani; Sugai; Shoji; Honda; Satoh; Fukumoto Journal of the Chemical Society. Perkin transactions 1, 1977 , # 10 p. 1151 - 1155 |
| Isooxyberberin |
| 8-oxoberberrubine |
| Methylnoroxyberberin |
| 9-Hydroxy-10-methoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isochino[3,2-a]isochinolin-8-on |
| 8-oxyberberrubine |
| 9-hydroxy-10-methoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-one |
| 9-Demethoxy-9-hydroxy-8-oxo-berberin |