[1,1'-Biphenyl]-2-amine,5-nitro structure
|
Common Name | [1,1'-Biphenyl]-2-amine,5-nitro | ||
|---|---|---|---|---|
| CAS Number | 29608-75-1 | Molecular Weight | 214.22000 | |
| Density | 1.268g/cm3 | Boiling Point | 412.5ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 4-nitro-2-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 412.5ºC at 760 mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 203.3ºC |
| Exact Mass | 214.07400 |
| PSA | 71.84000 |
| LogP | 3.94840 |
| Vapour Pressure | 5.15E-07mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | WFBXYWYRLONTJK-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])cc1-c1ccccc1 |
| HS Code | 2921499090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-phenyl-4-nitroaniline |
| 2-amino-5-nitro-biphenyl |
| 5-Nitro-biphenyl-2-ylamin |
| 5-nitro-biphenyl-2-ylamine |
| 5-nitrobiphenyl-2-amine |