3-(3-Phenyl-2-propenyl)-2,4-pentanedione
3-(3-Phenyl-2-propenyl)-2,4-pentanedione structure
|
Common Name | 3-(3-Phenyl-2-propenyl)-2,4-pentanedione | ||
|---|---|---|---|---|
| CAS Number | 29638-71-9 | Molecular Weight | 216.27600 | |
| Density | 1.042g/cm3 | Boiling Point | 160-164ºC 3mm | |
| Molecular Formula | C14H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.6ºC | |
Summary: 3-(3-Phenyl-2-propenyl)-2,4-pentanedione, also known as 3-(3-苯基-2-丙基)-2,4-戊二酮, with CAS number 29638-71-9, has a molecular formula of C14H16O2 and a molecular weight of 216.27600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-Phenyl-2-propenyl)-2,4-pentanedione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 160-164ºC 3mm |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.27600 |
| Flash Point | 145.6ºC |
| Exact Mass | 216.11500 |
| PSA | 34.14000 |
| LogP | 2.88410 |
| Vapour Pressure | 3.07E-06mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | PGEPOVPAPVUGAJ-RMKNXTFCSA-N |
| SMILES | CC(=O)C(CC=Cc1ccccc1)C(C)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914190090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:123-54-6
CAS#:4407-36-7
CAS#:21040-45-9
CAS#:516-09-6
CAS#:4393-06-0
CAS#:106625-70-1
CAS#:4392-24-9
CAS#:140-10-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-cinnamylpentane-2,4-dione |
| (phenyl-3 propene-2yl)-3 pentane dione-2,4 |
| 3-(3-phenylallyl)pentane-2,4-dione |
| trans-3-cinnamylpentane-2,4-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: InChIKey of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is PGEPOVPAPVUGAJ-RMKNXTFCSA-N. |
| Q: What is the molecular weight of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: Molecular weight of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is 216.27600. |
| Q: What is the CAS number of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: CAS number of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is 29638-71-9. |
| Q: What is the polar surface area (PSA) of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: Polar surface area (PSA) of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is 34.14000. |
| Q: What are the upstream materials of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: Related upstream materials(CAS) of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione: 123-54-6;4407-36-7;21040-45-9;516-09-6;4393-06-0;106625-70-1;4392-24-9;140-10-3. |
| Q: What is the LogP of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: LogP of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is 2.88410. |
| Q: What is the boiling point of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: Boiling point of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is 160-164ºC 3mm. |
| Q: What English synonyms does 3-(3-Phenyl-2-propenyl)-2,4-pentanedione have? |
| A: English synonyms of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione: 3-cinnamylpentane-2,4-dione, (phenyl-3 propene-2yl)-3 pentane dione-2,4, 3-(3-phenylallyl)pentane-2,4-dione, trans-3-cinnamylpentane-2,4-dione. |
| Q: What is the molecular formula of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: Molecular formula of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is C14H16O2. |
| Q: What is the English name of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione? |
| A: The English name of 3-(3-Phenyl-2-propenyl)-2,4-pentanedione is 3-(3-Phenyl-2-propenyl)-2,4-pentanedione. |