Benzoylcholine Chloride
Benzoylcholine Chloride structure
|
Common Name | Benzoylcholine Chloride | ||
|---|---|---|---|---|
| CAS Number | 29640-90-2 | Molecular Weight | 195.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Methyl-2-nitrophenylacetic acid (English name: 4-methyl-2-nitrophenylacetic acid, Common English name: Benzoylcholine Chloride, CAS number: 29640-90-2), molecular formula C9H9NO4, molecular weight 195.17200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-2-nitrophenylacetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9NO4 |
|---|---|
| Molecular Weight | 195.17200 |
| Exact Mass | 195.05300 |
| PSA | 83.12000 |
| LogP | 2.05350 |
| InChIKey | DXXWGXHJDCZCSN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CC(=O)O)c([N+](=O)[O-])c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916399090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (4-methyl-2-nitro-phenyl)-acetic acid |
| (4-Methyl-2-nitro-phenyl)-essigsaeure |
| 4-Methyl-2-nitrophenylessigsaeure |
| (4-Methyl-2-nitrophenyl)-essigsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-methyl-2-nitrophenylacetic acid? |
| A: SMILES notation of 4-methyl-2-nitrophenylacetic acid is Cc1ccc(CC(=O)O)c([N+](=O)[O-])c1. |
| Q: What is the English name of 4-methyl-2-nitrophenylacetic acid? |
| A: The English name of 4-methyl-2-nitrophenylacetic acid is 4-methyl-2-nitrophenylacetic acid. |
| Q: What is the polar surface area (PSA) of 4-methyl-2-nitrophenylacetic acid? |
| A: Polar surface area (PSA) of 4-methyl-2-nitrophenylacetic acid is 83.12000. |
| Q: What is the molecular weight of 4-methyl-2-nitrophenylacetic acid? |
| A: Molecular weight of 4-methyl-2-nitrophenylacetic acid is 195.17200. |
| Q: What is the CAS number of 4-methyl-2-nitrophenylacetic acid? |
| A: CAS number of 4-methyl-2-nitrophenylacetic acid is 29640-90-2. |
| Q: What is the InChIKey of 4-methyl-2-nitrophenylacetic acid? |
| A: InChIKey of 4-methyl-2-nitrophenylacetic acid is DXXWGXHJDCZCSN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 29640-90-2? |
| A: Chinese name of 29640-90-2 is 29640-90-2. |
| Q: What English synonyms does 4-methyl-2-nitrophenylacetic acid have? |
| A: English synonyms of 4-methyl-2-nitrophenylacetic acid: (4-methyl-2-nitro-phenyl)-acetic acid, (4-Methyl-2-nitro-phenyl)-essigsaeure, 4-Methyl-2-nitrophenylessigsaeure, (4-Methyl-2-nitrophenyl)-essigsaeure. |
| Q: What is the molecular formula of 4-methyl-2-nitrophenylacetic acid? |
| A: Molecular formula of 4-methyl-2-nitrophenylacetic acid is C9H9NO4. |
| Q: What is the LogP of 4-methyl-2-nitrophenylacetic acid? |
| A: LogP of 4-methyl-2-nitrophenylacetic acid is 2.05350. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |