2-(Benzoylamino)benzophenone structure
|
Common Name | 2-(Benzoylamino)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 29670-64-2 | Molecular Weight | 301.33900 | |
| Density | 1.222g/cm3 | Boiling Point | 420.2ºC at 760mmHg | |
| Molecular Formula | C20H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142ºC | |
| Name | N-(2-benzoylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 420.2ºC at 760mmHg |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.33900 |
| Flash Point | 142ºC |
| Exact Mass | 301.11000 |
| PSA | 49.66000 |
| LogP | 4.55390 |
| Vapour Pressure | 2.87E-07mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | HMCZRNIZFJNCEY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1C(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamido-2 benzophenone |
| 2-benzamidobenzophenone |
| N-Benzoyl-2-aminobenzophenone |