3-(4-methyl-1-oxophthalazin-2(1H)-yl)benzoic acid structure
|
Common Name | 3-(4-methyl-1-oxophthalazin-2(1H)-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 296790-56-2 | Molecular Weight | 280.27800 | |
| Density | 1.32g/cm3 | Boiling Point | 524.2ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.8ºC | |
| Name | 3-(4-methyl-1-oxophthalazin-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 524.2ºC at 760 mmHg |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.27800 |
| Flash Point | 270.8ºC |
| Exact Mass | 280.08500 |
| PSA | 72.19000 |
| LogP | 2.39230 |
| Vapour Pressure | 8.15E-12mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | WEOHRRADPCYDSW-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2cccc(C(=O)O)c2)c(=O)c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms1379l03 |