9H-Fluoren-9-one,2,5-difluoro- structure
|
Common Name | 9H-Fluoren-9-one,2,5-difluoro- | ||
|---|---|---|---|---|
| CAS Number | 2969-61-1 | Molecular Weight | 216.18300 | |
| Density | 1.41g/cm3 | Boiling Point | 353.7ºC at 760mmHg | |
| Molecular Formula | C13H6F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.4ºC | |
| Name | 2,5-difluorofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 353.7ºC at 760mmHg |
| Molecular Formula | C13H6F2O |
| Molecular Weight | 216.18300 |
| Flash Point | 135.4ºC |
| Exact Mass | 216.03900 |
| PSA | 17.07000 |
| LogP | 3.17620 |
| Vapour Pressure | 3.53E-05mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | XBKGWIVVBXZUBM-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(F)ccc2-c2c(F)cccc21 |
| HS Code | 2914700090 |
|---|
|
~%
9H-Fluoren-9-on... CAS#:2969-61-1 |
| Literature: Namkung,M.J. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 551 - 554 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,5-difluorofluorenone |
| 2,5-Difluor-fluorenon |
| 2,5-difluoro-9h-fluoren-9-one |
| 9H-Fluoren-9-one,2,5-difluoro |
| 2,5-difluoro-9-fluorenone |