2,2'-[(4-fluoro-3-nitrophenyl)imino]diethanol structure
|
Common Name | 2,2'-[(4-fluoro-3-nitrophenyl)imino]diethanol | ||
|---|---|---|---|---|
| CAS Number | 29705-38-2 | Molecular Weight | 244.22000 | |
| Density | 1.424g/cm3 | Boiling Point | 454.6ºC at 760mmHg | |
| Molecular Formula | C10H13FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | 2-[4-fluoro-N-(2-hydroxyethyl)-3-nitroanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760mmHg |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22000 |
| Flash Point | 228.7ºC |
| Exact Mass | 244.08600 |
| PSA | 89.52000 |
| LogP | 1.04810 |
| Vapour Pressure | 4.7E-09mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | ZZJIOLHDWAXCSE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(N(CCO)CCO)ccc1F |
| Storage condition | 2-8°C |
| HS Code | 2922199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-bis(2-hydroxyethyl)-4fluoro-3-nitroaniline |
| 4-fluoro-3-nitro-N,N,-bis(2-hydroxyethyl)-aminobenzene |
| 2-((4-fluoro-3-nitrophenyl)(2-hydroxyethyl)amino)ethanol |
| 2,2'-[(4-fluoro-3-nitrophenyl)imino]bisethanol |
| 2,2'-[(4-fluoro-3-nitrophenyl)imino]diethanol |
| N,N-Bis-(Hydroxyethyl)-4-Fluoro-3-Nitroaniline |
| 2,2'-((4-Fluoro-3-nitrophenyl)azanediyl)diethanol |
| EINECS 249-787-4 |
| 4-fluoro-3-nitro-N,N-di-(2-hydroxyethyl)-aniline |